C18H36O6Si2 — CID 14531359
5-O-ethyl 1-O,3-O-dimethyl 1,3-bis(trimethylsilyl)pentane-1,3,5-tricarboxylate (PubChem CID 14531359) has the molecular formula C18H36O6Si2 and a molecular weight of 404.65 g/mol. Its IUPAC name is 5-O-ethyl 1-O,3-O-dimethyl 1,3-bis(trimethylsilyl)pentane-1,3,5-tricarboxylate.
| Compound Name | 5-O-ethyl 1-O,3-O-dimethyl 1,3-bis(trimethylsilyl)pentane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 14531359 |
| Molecular Formula | C18H36O6Si2 |
| Molecular Weight | 404.65 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 5-O-ethyl 1-O,3-O-dimethyl 1,3-bis(trimethylsilyl)pentane-1,3,5-tricarboxylate |
| SMILES | CCOC(=O)CCC(CC(C(=O)OC)[Si](C)(C)C)(C(=O)OC)[Si](C)(C)C |
| InChI | InChI=1S/C18H36O6Si2/c1-10-24-15(19)11-12-18(17(21)23-3,26(7,8)9)13-14(16(20)22-2)25(4,5)6/h14H,10-13H2,1-9H3 |
| InChIKey | XLFVJPAVLVEFCV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|