C21H44O6Si3 — CID 14531363
1-O-ethyl 3-O,5-O-dimethyl 1,3,5-tris(trimethylsilyl)pentane-1,3,5-tricarboxylate (PubChem CID 14531363) has the molecular formula C21H44O6Si3 and a molecular weight of 476.84 g/mol. Its IUPAC name is 1-O-ethyl 3-O,5-O-dimethyl 1,3,5-tris(trimethylsilyl)pentane-1,3,5-tricarboxylate.
| Compound Name | 1-O-ethyl 3-O,5-O-dimethyl 1,3,5-tris(trimethylsilyl)pentane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 14531363 |
| Molecular Formula | C21H44O6Si3 |
| Molecular Weight | 476.84 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 1-O-ethyl 3-O,5-O-dimethyl 1,3,5-tris(trimethylsilyl)pentane-1,3,5-tricarboxylate |
| SMILES | CCOC(=O)C(CC(CC(C(=O)OC)[Si](C)(C)C)(C(=O)OC)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C21H44O6Si3/c1-13-27-19(23)17(29(7,8)9)15-21(20(24)26-3,30(10,11)12)14-16(18(22)25-2)28(4,5)6/h16-17H,13-15H2,1-12H3 |
| InChIKey | XHVJXTKMTNGFEU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.84 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|