About 1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate
1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate (PubChem CID 145314546) has the molecular formula C28H46N2O6
and a molecular weight of 506.68 g/mol. Its IUPAC name is 1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate.
Molecular Properties
| Compound Name | 1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate |
| PubChem CID | 145314546 |
| Molecular Formula | C28H46N2O6 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | 1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate |
| SMILES | O=C(/C=C\CCC(=O)OCCCCCCN1CCCC1=O)OCCCCCCN1CCCCCC1=O |
| InChI | InChI=1S/C28H46N2O6/c31-25-15-6-5-11-21-29(25)19-9-1-3-12-23-35-27(33)17-7-8-18-28(34)36-24-13-4-2-10-20-30-22-14-16-26(30)32/h7,17H,1-6,8-16,18-24H2/b17-7- |
| InChIKey | XYBQLDAQODTNJA-IDUWFGFVSA-N |
| XLogP | 4.55 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate?
The IUPAC name of 1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate (CID 145314546) is 1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate.
What is the SMILES notation for 1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate?
The canonical SMILES for 1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate is O=C(/C=C\CCC(=O)OCCCCCCN1CCCC1=O)OCCCCCCN1CCCCCC1=O.
What is the InChIKey of 1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate?
The InChIKey is XYBQLDAQODTNJA-IDUWFGFVSA-N. The full InChI is InChI=1S/C28H46N2O6/c31-25-15-6-5-11-21-29(25)19-9-1-3-12-23-35-27(33)17-7-8-18-28(34)36-24-13-4-2-10-20-30-22-14-16-26(30)32/h7,17H,1-6,8-16,18-24H2/b17-7-.
What are the key properties of 1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate?
1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate has a molecular weight of 506.68 g/mol, XLogP of 4.55, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[6-(2-oxoazepan-1-yl)hexyl] 6-O-[6-(2-oxopyrrolidin-1-yl)hexyl] (Z)-hex-2-enedioate is sourced from PubChem (CID 145314546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).