About ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline
ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline (PubChem CID 145314950) has the molecular formula C15H24N2S2
and a molecular weight of 296.51 g/mol. Its IUPAC name is ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline.
Molecular Properties
| Compound Name | ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline |
| PubChem CID | 145314950 |
| Molecular Formula | C15H24N2S2 |
| Molecular Weight | 296.51 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline |
| SMILES | CC.CC.CSc1nc2ccc(C)cc2nc1SC |
| InChI | InChI=1S/C11H12N2S2.2C2H6/c1-7-4-5-8-9(6-7)13-11(15-3)10(12-8)14-2;2*1-2/h4-6H,1-3H3;2*1-2H3 |
| InChIKey | DWHKPLRYGFJDID-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline?
The IUPAC name of ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline (CID 145314950) is ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline.
What is the SMILES notation for ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline?
The canonical SMILES for ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline is CC.CC.CSc1nc2ccc(C)cc2nc1SC.
What is the InChIKey of ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline?
The InChIKey is DWHKPLRYGFJDID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2S2.2C2H6/c1-7-4-5-8-9(6-7)13-11(15-3)10(12-8)14-2;2*1-2/h4-6H,1-3H3;2*1-2H3.
What are the key properties of ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline?
ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline has a molecular weight of 296.51 g/mol, XLogP of 5.43, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methyl-2,3-bis(methylsulfanyl)quinoxaline is sourced from PubChem (CID 145314950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).