C15H32N5O2+ — CID 145315282
diaminomethylidene-[4-oxo-4-[[2,2,4,4-tetramethyl-5-(methylamino)-5-oxopentyl]amino]butyl]azanium (PubChem CID 145315282) has the molecular formula C15H32N5O2+ and a molecular weight of 314.45 g/mol. Its IUPAC name is diaminomethylidene-[4-oxo-4-[[2,2,4,4-tetramethyl-5-(methylamino)-5-oxopentyl]amino]butyl]azanium.
| Compound Name | diaminomethylidene-[4-oxo-4-[[2,2,4,4-tetramethyl-5-(methylamino)-5-oxopentyl]amino]butyl]azanium |
|---|---|
| PubChem CID | 145315282 |
| Molecular Formula | C15H32N5O2+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | diaminomethylidene-[4-oxo-4-[[2,2,4,4-tetramethyl-5-(methylamino)-5-oxopentyl]amino]butyl]azanium |
| SMILES | CNC(=O)C(C)(C)CC(C)(C)CNC(=O)CCC[NH+]=C(N)N |
| InChI | InChI=1S/C15H31N5O2/c1-14(2,9-15(3,4)12(22)18-5)10-20-11(21)7-6-8-19-13(16)17/h6-10H2,1-5H3,(H,18,22)(H,20,21)(H4,16,17,19)/p+1 |
| InChIKey | YZUGVKYALXDDHO-UHFFFAOYSA-O |
| XLogP | -1.57 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|