About N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine
N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine (PubChem CID 145315446) has the molecular formula C6H4IN3S
and a molecular weight of 277.09 g/mol. Its IUPAC name is N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine.
Molecular Properties
| Compound Name | N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine |
| PubChem CID | 145315446 |
| Molecular Formula | C6H4IN3S |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 276.92 |
| IUPAC Name | N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine |
| SMILES | INc1nsc2ncccc12 |
| InChI | InChI=1S/C6H4IN3S/c7-9-5-4-2-1-3-8-6(4)11-10-5/h1-3H,(H,9,10) |
| InChIKey | JVAWMNCWGBPEHV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine?
The IUPAC name of N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine (CID 145315446) is N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine.
What is the SMILES notation for N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine?
The canonical SMILES for N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine is INc1nsc2ncccc12.
What is the InChIKey of N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine?
The InChIKey is JVAWMNCWGBPEHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4IN3S/c7-9-5-4-2-1-3-8-6(4)11-10-5/h1-3H,(H,9,10).
What are the key properties of N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine?
N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine has a molecular weight of 277.09 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-iodo-[1,2]thiazolo[5,4-b]pyridin-3-amine is sourced from PubChem (CID 145315446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).