C24H30N6O — CID 145315504
9-[[4-(ethylamino)phenyl]methyl]-2-(2-propan-2-ylphenyl)-7H-purin-8-one;methanimine;molecular hydrogen (PubChem CID 145315504) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 9-[[4-(ethylamino)phenyl]methyl]-2-(2-propan-2-ylphenyl)-7H-purin-8-one;methanimine;molecular hydrogen.
| Compound Name | 9-[[4-(ethylamino)phenyl]methyl]-2-(2-propan-2-ylphenyl)-7H-purin-8-one;methanimine;molecular hydrogen |
|---|---|
| PubChem CID | 145315504 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 9-[[4-(ethylamino)phenyl]methyl]-2-(2-propan-2-ylphenyl)-7H-purin-8-one;methanimine;molecular hydrogen |
| SMILES | CCNc1ccc(Cn2c(=O)[nH]c3cnc(-c4ccccc4C(C)C)nc32)cc1.[H]N=C.[H][H] |
| InChI | InChI=1S/C23H25N5O.CH3N.H2/c1-4-24-17-11-9-16(10-12-17)14-28-22-20(26-23(28)29)13-25-21(27-22)19-8-6-5-7-18(19)15(2)3;1-2;/h5-13,15,24H,4,14H2,1-3H3,(H,26,29);2H,1H2;1H |
| InChIKey | IJCQHWYBPKXUCX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 99.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|