About 5-methylhex-5-enylurea
5-methylhex-5-enylurea (PubChem CID 145315541) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 5-methylhex-5-enylurea.
Molecular Properties
| Compound Name | 5-methylhex-5-enylurea |
| PubChem CID | 145315541 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 5-methylhex-5-enylurea |
| SMILES | C=C(C)CCCCNC(N)=O |
| InChI | InChI=1S/C8H16N2O/c1-7(2)5-3-4-6-10-8(9)11/h1,3-6H2,2H3,(H3,9,10,11) |
| InChIKey | LREWANXNOMKSQD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhex-5-enylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhex-5-enylurea?
The IUPAC name of 5-methylhex-5-enylurea (CID 145315541) is 5-methylhex-5-enylurea.
What is the SMILES notation for 5-methylhex-5-enylurea?
The canonical SMILES for 5-methylhex-5-enylurea is C=C(C)CCCCNC(N)=O.
What is the InChIKey of 5-methylhex-5-enylurea?
The InChIKey is LREWANXNOMKSQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-7(2)5-3-4-6-10-8(9)11/h1,3-6H2,2H3,(H3,9,10,11).
What are the key properties of 5-methylhex-5-enylurea?
5-methylhex-5-enylurea has a molecular weight of 156.23 g/mol, XLogP of 1.40, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhex-5-enylurea is sourced from PubChem (CID 145315541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).