About (3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone
(3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone (PubChem CID 145315606) has the molecular formula C12H19N5O
and a molecular weight of 249.32 g/mol. Its IUPAC name is (3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone.
Molecular Properties
| Compound Name | (3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone |
| PubChem CID | 145315606 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | (3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone |
| SMILES | Nc1ccn(C(=O)N2CCC3(CCCN3)CC2)n1 |
| InChI | InChI=1S/C12H19N5O/c13-10-2-7-17(15-10)11(18)16-8-4-12(5-9-16)3-1-6-14-12/h2,7,14H,1,3-6,8-9H2,(H2,13,15) |
| InChIKey | IKSKLZQWIMIGPY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone?
The IUPAC name of (3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone (CID 145315606) is (3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone.
What is the SMILES notation for (3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone?
The canonical SMILES for (3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone is Nc1ccn(C(=O)N2CCC3(CCCN3)CC2)n1.
What is the InChIKey of (3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone?
The InChIKey is IKSKLZQWIMIGPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N5O/c13-10-2-7-17(15-10)11(18)16-8-4-12(5-9-16)3-1-6-14-12/h2,7,14H,1,3-6,8-9H2,(H2,13,15).
What are the key properties of (3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone?
(3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone has a molecular weight of 249.32 g/mol, XLogP of 0.65, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminopyrazol-1-yl)-(1,8-diazaspiro[4.5]decan-8-yl)methanone is sourced from PubChem (CID 145315606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).