C24H40ClN5O2 — CID 145315915
1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)pyrazole-4-carboxamide;(2Z,4Z)-3-chloro-2-ethyl-N,N-dimethylhexa-2,4-dien-1-amine;ethane (PubChem CID 145315915) has the molecular formula C24H40ClN5O2 and a molecular weight of 466.07 g/mol. Its IUPAC name is 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)pyrazole-4-carboxamide;(2Z,4Z)-3-chloro-2-ethyl-N,N-dimethylhexa-2,4-dien-1-amine;ethane.
| Compound Name | 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)pyrazole-4-carboxamide;(2Z,4Z)-3-chloro-2-ethyl-N,N-dimethylhexa-2,4-dien-1-amine;ethane |
|---|---|
| PubChem CID | 145315915 |
| Molecular Formula | C24H40ClN5O2 |
| Molecular Weight | 466.07 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)pyrazole-4-carboxamide;(2Z,4Z)-3-chloro-2-ethyl-N,N-dimethylhexa-2,4-dien-1-amine;ethane |
| SMILES | C/C=C\C(Cl)=C(/CC)CN(C)C.CC.NC(=O)c1cnn(C(=O)N2CC3CCCC3C2)c1 |
| InChI | InChI=1S/C12H16N4O2.C10H18ClN.C2H6/c13-11(17)10-4-14-16(7-10)12(18)15-5-8-2-1-3-9(8)6-15;1-5-7-10(11)9(6-2)8-12(3)4;1-2/h4,7-9H,1-3,5-6H2,(H2,13,17);5,7H,6,8H2,1-4H3;1-2H3/b;7-5-,10-9-; |
| InChIKey | RRLUYZXZEUJUNI-BYNVZBQFSA-N |
| XLogP | 4.74 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.07 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|