C15H27N5O2 — CID 145316466
tert-butyl pyrrolidine-1-carboxylate;5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 145316466) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl pyrrolidine-1-carboxylate;5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | tert-butyl pyrrolidine-1-carboxylate;5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 145316466 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | tert-butyl pyrrolidine-1-carboxylate;5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CC(C)(C)OC(=O)N1CCCC1.CC1CNCc2nncn21 |
| InChI | InChI=1S/C9H17NO2.C6H10N4/c1-9(2,3)12-8(11)10-6-4-5-7-10;1-5-2-7-3-6-9-8-4-10(5)6/h4-7H2,1-3H3;4-5,7H,2-3H2,1H3 |
| InChIKey | OQOLRUCJWZZBOJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |