C27H45NO3 — CID 145316661
[1-[2-[(3R,6aS,7R,10bR)-3-cyclopentyl-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethyl]pyrrolidin-3-yl]methanol (PubChem CID 145316661) has the molecular formula C27H45NO3 and a molecular weight of 431.66 g/mol. Its IUPAC name is [1-[2-[(3R,6aS,7R,10bR)-3-cyclopentyl-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethyl]pyrrolidin-3-yl]methanol.
| Compound Name | [1-[2-[(3R,6aS,7R,10bR)-3-cyclopentyl-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethyl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 145316661 |
| Molecular Formula | C27H45NO3 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | [1-[2-[(3R,6aS,7R,10bR)-3-cyclopentyl-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethyl]pyrrolidin-3-yl]methanol |
| SMILES | C=C1CCC2[C@]3(C)CO[C@@H](C4CCCC4)OC3CC[C@@]2(C)[C@@H]1CCN1CCC(CO)C1 |
| InChI | InChI=1S/C27H45NO3/c1-19-8-9-23-26(2,22(19)12-15-28-14-11-20(16-28)17-29)13-10-24-27(23,3)18-30-25(31-24)21-6-4-5-7-21/h20-25,29H,1,4-18H2,2-3H3/t20?,22-,23?,24?,25-,26+,27+/m1/s1 |
| InChIKey | YIAYPBIJFRILBR-WVMQRBLISA-N |
| XLogP | 5.01 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|