About 3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine
3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine (PubChem CID 145316678) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine |
| PubChem CID | 145316678 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine |
| SMILES | C=C[C@H](CC)CCOCCCN(C)C |
| InChI | InChI=1S/C12H25NO/c1-5-12(6-2)8-11-14-10-7-9-13(3)4/h5,12H,1,6-11H2,2-4H3/t12-/m1/s1 |
| InChIKey | ULQGYXLJKRFYGL-GFCCVEGCSA-N |
| XLogP | 2.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine (CID 145316678) is 3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine is C=C[C@H](CC)CCOCCCN(C)C.
What is the InChIKey of 3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine?
The InChIKey is ULQGYXLJKRFYGL-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H25NO/c1-5-12(6-2)8-11-14-10-7-9-13(3)4/h5,12H,1,6-11H2,2-4H3/t12-/m1/s1.
What are the key properties of 3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine?
3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine has a molecular weight of 199.34 g/mol, XLogP of 2.56, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R)-3-ethylpent-4-enoxy]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 145316678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).