C23H34O3 — CID 145316697
2-[(3R,6aR)-3-cyclopent-2-en-1-yl-8-ethyl-6a,8-dimethyl-4a,5,6,7,10a,10b-hexahydro-1H-naphtho[2,1-d][1,3]dioxin-7-yl]acetaldehyde (PubChem CID 145316697) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 2-[(3R,6aR)-3-cyclopent-2-en-1-yl-8-ethyl-6a,8-dimethyl-4a,5,6,7,10a,10b-hexahydro-1H-naphtho[2,1-d][1,3]dioxin-7-yl]acetaldehyde.
| Compound Name | 2-[(3R,6aR)-3-cyclopent-2-en-1-yl-8-ethyl-6a,8-dimethyl-4a,5,6,7,10a,10b-hexahydro-1H-naphtho[2,1-d][1,3]dioxin-7-yl]acetaldehyde |
|---|---|
| PubChem CID | 145316697 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2-[(3R,6aR)-3-cyclopent-2-en-1-yl-8-ethyl-6a,8-dimethyl-4a,5,6,7,10a,10b-hexahydro-1H-naphtho[2,1-d][1,3]dioxin-7-yl]acetaldehyde |
| SMILES | CCC1(C)C=CC2C3CO[C@@H](C4C=CCC4)OC3CC[C@@]2(C)C1CC=O |
| InChI | InChI=1S/C23H34O3/c1-4-22(2)12-9-18-17-15-25-21(16-7-5-6-8-16)26-19(17)10-13-23(18,3)20(22)11-14-24/h5,7,9,12,14,16-21H,4,6,8,10-11,13,15H2,1-3H3/t16?,17?,18?,19?,20?,21-,22?,23-/m1/s1 |
| InChIKey | MWHDLHAMYXMOPF-XUWHGHAVSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|