C16H28O3 — CID 145316820
1-(hydroxymethyl)-5-(2-methoxyethyl)-4a-methyl-6-methylidene-1,2,3,4,5,7,8,8a-octahydronaphthalen-2-ol (PubChem CID 145316820) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-(hydroxymethyl)-5-(2-methoxyethyl)-4a-methyl-6-methylidene-1,2,3,4,5,7,8,8a-octahydronaphthalen-2-ol.
| Compound Name | 1-(hydroxymethyl)-5-(2-methoxyethyl)-4a-methyl-6-methylidene-1,2,3,4,5,7,8,8a-octahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 145316820 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 1-(hydroxymethyl)-5-(2-methoxyethyl)-4a-methyl-6-methylidene-1,2,3,4,5,7,8,8a-octahydronaphthalen-2-ol |
| SMILES | C=C1CCC2C(CO)C(O)CCC2(C)C1CCOC |
| InChI | InChI=1S/C16H28O3/c1-11-4-5-14-12(10-17)15(18)6-8-16(14,2)13(11)7-9-19-3/h12-15,17-18H,1,4-10H2,2-3H3 |
| InChIKey | DOOIHCZWNHVYDN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|