C13H23NO — CID 145316990
(3E)-N-ethyl-N,5-dimethyl-4-propoxyhexa-1,3,5-trien-2-amine (PubChem CID 145316990) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (3E)-N-ethyl-N,5-dimethyl-4-propoxyhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-N-ethyl-N,5-dimethyl-4-propoxyhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 145316990 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (3E)-N-ethyl-N,5-dimethyl-4-propoxyhexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C(=C\C(=C)N(C)CC)OCCC |
| InChI | InChI=1S/C13H23NO/c1-7-9-15-13(11(3)4)10-12(5)14(6)8-2/h10H,3,5,7-9H2,1-2,4,6H3/b13-10+ |
| InChIKey | IBYGXXIZAPUGDG-JLHYYAGUSA-N |
| XLogP | 3.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|