C13H27N5O — CID 145317201
(Z)-3-[amino-[1-(oxan-4-yl)piperidin-4-yl]amino]prop-2-ene-1,2-diamine (PubChem CID 145317201) has the molecular formula C13H27N5O and a molecular weight of 269.39 g/mol. Its IUPAC name is (Z)-3-[amino-[1-(oxan-4-yl)piperidin-4-yl]amino]prop-2-ene-1,2-diamine.
| Compound Name | (Z)-3-[amino-[1-(oxan-4-yl)piperidin-4-yl]amino]prop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 145317201 |
| Molecular Formula | C13H27N5O |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | (Z)-3-[amino-[1-(oxan-4-yl)piperidin-4-yl]amino]prop-2-ene-1,2-diamine |
| SMILES | NC/C(N)=C/N(N)C1CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C13H27N5O/c14-9-11(15)10-18(16)13-1-5-17(6-2-13)12-3-7-19-8-4-12/h10,12-13H,1-9,14-16H2/b11-10- |
| InChIKey | JDNBXIHYROEYKQ-KHPPLWFESA-N |
| XLogP | -0.44 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|