About butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate
butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate (PubChem CID 145317303) has the molecular formula C12H25N3O4
and a molecular weight of 275.35 g/mol. Its IUPAC name is butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate.
Molecular Properties
| Compound Name | butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate |
| PubChem CID | 145317303 |
| Molecular Formula | C12H25N3O4 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate |
| SMILES | CCCC.COC(=O)CCNC(=O)CNC(=O)CN |
| InChI | InChI=1S/C8H15N3O4.C4H10/c1-15-8(14)2-3-10-7(13)5-11-6(12)4-9;1-3-4-2/h2-5,9H2,1H3,(H,10,13)(H,11,12);3-4H2,1-2H3 |
| InChIKey | MBNZRQWSISBZQV-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate?
The IUPAC name of butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate (CID 145317303) is butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate.
What is the SMILES notation for butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate?
The canonical SMILES for butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate is CCCC.COC(=O)CCNC(=O)CNC(=O)CN.
What is the InChIKey of butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate?
The InChIKey is MBNZRQWSISBZQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O4.C4H10/c1-15-8(14)2-3-10-7(13)5-11-6(12)4-9;1-3-4-2/h2-5,9H2,1H3,(H,10,13)(H,11,12);3-4H2,1-2H3.
What are the key properties of butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate?
butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate has a molecular weight of 275.35 g/mol, XLogP of -0.45, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butane;methyl 3-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate is sourced from PubChem (CID 145317303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).