C27H41O2P — CID 145317942
cyclohexyl-[2-[(3E)-2,4-dimethoxyhexa-1,3,5-trien-3-yl]phenyl]-heptan-3-ylphosphane (PubChem CID 145317942) has the molecular formula C27H41O2P and a molecular weight of 428.60 g/mol. Its IUPAC name is cyclohexyl-[2-[(3E)-2,4-dimethoxyhexa-1,3,5-trien-3-yl]phenyl]-heptan-3-ylphosphane.
| Compound Name | cyclohexyl-[2-[(3E)-2,4-dimethoxyhexa-1,3,5-trien-3-yl]phenyl]-heptan-3-ylphosphane |
|---|---|
| PubChem CID | 145317942 |
| Molecular Formula | C27H41O2P |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | cyclohexyl-[2-[(3E)-2,4-dimethoxyhexa-1,3,5-trien-3-yl]phenyl]-heptan-3-ylphosphane |
| SMILES | C=C/C(OC)=C(\C(=C)OC)c1ccccc1P(C(CC)CCCC)C1CCCCC1 |
| InChI | InChI=1S/C27H41O2P/c1-7-10-16-22(8-2)30(23-17-12-11-13-18-23)26-20-15-14-19-24(26)27(21(4)28-5)25(9-3)29-6/h9,14-15,19-20,22-23H,3-4,7-8,10-13,16-18H2,1-2,5-6H3/b27-25- |
| InChIKey | GSHLPDYZSGYDKM-RFBIWTDZSA-N |
| XLogP | 7.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|