C16H21ClN2O — CID 145320368
2-[(Z,3E)-6-chloro-3-ethylidenehex-4-en-2-yl]-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one (PubChem CID 145320368) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-[(Z,3E)-6-chloro-3-ethylidenehex-4-en-2-yl]-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one.
| Compound Name | 2-[(Z,3E)-6-chloro-3-ethylidenehex-4-en-2-yl]-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one |
|---|---|
| PubChem CID | 145320368 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[(Z,3E)-6-chloro-3-ethylidenehex-4-en-2-yl]-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one |
| SMILES | C/C=C(\C=C/CCl)C(C)N1CCn2ccc(=O)cc2C1 |
| InChI | InChI=1S/C16H21ClN2O/c1-3-14(5-4-7-17)13(2)19-10-9-18-8-6-16(20)11-15(18)12-19/h3-6,8,11,13H,7,9-10,12H2,1-2H3/b5-4-,14-3+ |
| InChIKey | PVWPQLVLEVEYTF-QVQLBOQVSA-N |
| XLogP | 2.79 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|