About ethane;3-ethyl-2,4-dimethylcyclohepta-1,3,5-triene
ethane;3-ethyl-2,4-dimethylcyclohepta-1,3,5-triene (PubChem CID 145320369) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is ethane;3-ethyl-2,4-dimethylcyclohepta-1,3,5-triene.
Analyze ethane;3-ethyl-2,4-dimethylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-2,4-dimethylcyclohepta-1,3,5-triene?
The IUPAC name of ethane;3-ethyl-2,4-dimethylcyclohepta-1,3,5-triene (CID 145320369) is ethane;3-ethyl-2,4-dimethylcyclohepta-1,3,5-triene.
What is the SMILES notation for ethane;3-ethyl-2,4-dimethylcyclohepta-1,3,5-triene?
The canonical SMILES for ethane;3-ethyl-2,4-dimethylcyclohepta-1,3,5-triene is CC.CCC1=C(C)C=CCC=C1C.
What is the InChIKey of ethane;3-ethyl-2,4-dimethylcyclohepta-1,3,5-triene?
The InChIKey is NOQPHJXHULSWTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C2H6/c1-4-11-9(2)7-5-6-8-10(11)3;1-2/h5,7-8H,4,6H2,1-3H3;1-2H3.
What are the key properties of ethane;3-ethyl-2,4-dimethylcyclohepta-1,3,5-triene?
ethane;3-ethyl-2,4-dimethylcyclohepta-1,3,5-triene has a molecular weight of 178.32 g/mol, XLogP of 4.65, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-2,4-dimethylcyclohepta-1,3,5-triene is sourced from PubChem (CID 145320369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).