C18H13BO2 — CID 145320623
8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,19-octaene (PubChem CID 145320623) has the molecular formula C18H13BO2 and a molecular weight of 272.11 g/mol. Its IUPAC name is 8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,19-octaene.
| Compound Name | 8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,19-octaene |
|---|---|
| PubChem CID | 145320623 |
| Molecular Formula | C18H13BO2 |
| Molecular Weight | 272.11 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,19-octaene |
| SMILES | C1=C2Oc3cccc4c3B(C2=CCC1)c1ccccc1O4 |
| InChI | InChI=1S/C18H13BO2/c1-3-8-14-12(6-1)19-13-7-2-4-9-15(13)21-17-11-5-10-16(20-14)18(17)19/h1,3,5-11H,2,4H2 |
| InChIKey | FNLAKYOIAXGPKT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.11 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|