C9H13NO — CID 145321809
4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine (PubChem CID 145321809) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine.
| Compound Name | 4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 145321809 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine |
| SMILES | CN1CCOC2=C1C=CCC2 |
| InChI | InChI=1S/C9H13NO/c1-10-6-7-11-9-5-3-2-4-8(9)10/h2,4H,3,5-7H2,1H3 |
| InChIKey | HDASKTAQELGBDA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |