C51H44N4S2 — CID 145321926
2-N-(5,6-dihydronaphthalen-1-yl)-7-N-(1H-indol-5-yl)-9,9-dimethyl-2-N-phenyl-7-N-(4-phenylphenyl)fluorene-2,7-diamine;S-sulfanylthiohydroxylamine (PubChem CID 145321926) has the molecular formula C51H44N4S2 and a molecular weight of 777.08 g/mol. Its IUPAC name is 2-N-(5,6-dihydronaphthalen-1-yl)-7-N-(1H-indol-5-yl)-9,9-dimethyl-2-N-phenyl-7-N-(4-phenylphenyl)fluorene-2,7-diamine;S-sulfanylthiohydroxylamine.
| Compound Name | 2-N-(5,6-dihydronaphthalen-1-yl)-7-N-(1H-indol-5-yl)-9,9-dimethyl-2-N-phenyl-7-N-(4-phenylphenyl)fluorene-2,7-diamine;S-sulfanylthiohydroxylamine |
|---|---|
| PubChem CID | 145321926 |
| Molecular Formula | C51H44N4S2 |
| Molecular Weight | 777.08 g/mol |
| Exact Mass | 776.30 |
| IUPAC Name | 2-N-(5,6-dihydronaphthalen-1-yl)-7-N-(1H-indol-5-yl)-9,9-dimethyl-2-N-phenyl-7-N-(4-phenylphenyl)fluorene-2,7-diamine;S-sulfanylthiohydroxylamine |
| SMILES | CC1(C)c2cc(N(c3ccc(-c4ccccc4)cc3)c3ccc4[nH]ccc4c3)ccc2-c2ccc(N(c3ccccc3)c3cccc4c3C=CCC4)cc21.NSS |
| InChI | InChI=1S/C51H41N3.H3NS2/c1-51(2)47-33-42(53(41-26-29-49-38(32-41)30-31-52-49)40-22-20-36(21-23-40)35-12-5-3-6-13-35)24-27-45(47)46-28-25-43(34-48(46)51)54(39-16-7-4-8-17-39)50-19-11-15-37-14-9-10-18-44(37)50;1-3-2/h3-8,10-13,15-34,52H,9,14H2,1-2H3;2H,1H2 |
| InChIKey | UXUCJUDCXMHJMB-UHFFFAOYSA-N |
| XLogP | 14.48 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.08 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|