C30H40O3 — CID 14532284
(2,6-ditert-butyl-4-methoxyphenyl) (1S,2S)-2-butyl-1,2-dihydronaphthalene-1-carboxylate (PubChem CID 14532284) has the molecular formula C30H40O3 and a molecular weight of 448.65 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methoxyphenyl) (1S,2S)-2-butyl-1,2-dihydronaphthalene-1-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methoxyphenyl) (1S,2S)-2-butyl-1,2-dihydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 14532284 |
| Molecular Formula | C30H40O3 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (2,6-ditert-butyl-4-methoxyphenyl) (1S,2S)-2-butyl-1,2-dihydronaphthalene-1-carboxylate |
| SMILES | CCCC[C@H]1C=Cc2ccccc2[C@H]1C(=O)Oc1c(C(C)(C)C)cc(OC)cc1C(C)(C)C |
| InChI | InChI=1S/C30H40O3/c1-9-10-13-21-17-16-20-14-11-12-15-23(20)26(21)28(31)33-27-24(29(2,3)4)18-22(32-8)19-25(27)30(5,6)7/h11-12,14-19,21,26H,9-10,13H2,1-8H3/t21-,26-/m0/s1 |
| InChIKey | MNAQXANYAAQZRO-LVXARBLLSA-N |
| XLogP | 7.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|