About fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine
fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine (PubChem CID 145322972) has the molecular formula C8H15F2N
and a molecular weight of 163.21 g/mol. Its IUPAC name is fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine.
Molecular Properties
| Compound Name | fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine |
| PubChem CID | 145322972 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine |
| SMILES | C=CC(F)N1CCCC1.CF |
| InChI | InChI=1S/C7H12FN.CH3F/c1-2-7(8)9-5-3-4-6-9;1-2/h2,7H,1,3-6H2;1H3 |
| InChIKey | GVSIWYWCXGYNII-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine?
The IUPAC name of fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine (CID 145322972) is fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine.
What is the SMILES notation for fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine?
The canonical SMILES for fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine is C=CC(F)N1CCCC1.CF.
What is the InChIKey of fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine?
The InChIKey is GVSIWYWCXGYNII-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12FN.CH3F/c1-2-7(8)9-5-3-4-6-9;1-2/h2,7H,1,3-6H2;1H3.
What are the key properties of fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine?
fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine has a molecular weight of 163.21 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;1-(1-fluoroprop-2-enyl)pyrrolidine is sourced from PubChem (CID 145322972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).