About methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene
methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene (PubChem CID 145323256) has the molecular formula C28H27ClN4O3
and a molecular weight of 503.00 g/mol. Its IUPAC name is methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene.
Molecular Properties
| Compound Name | methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene |
| PubChem CID | 145323256 |
| Molecular Formula | C28H27ClN4O3 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene |
| SMILES | COC(=O)Nc1ccc(C(=O)NCc2ccc(-c3cc(Cl)ccc3N)cn2)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C21H19ClN4O3.C7H8/c1-29-21(28)26-16-6-2-13(3-7-16)20(27)25-12-17-8-4-14(11-24-17)18-10-15(22)5-9-19(18)23;1-7-5-3-2-4-6-7/h2-11H,12,23H2,1H3,(H,25,27)(H,26,28);2-6H,1H3 |
| InChIKey | LYRHDEPXGSDCFM-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene?
The IUPAC name of methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene (CID 145323256) is methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene.
What is the SMILES notation for methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene?
The canonical SMILES for methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene is COC(=O)Nc1ccc(C(=O)NCc2ccc(-c3cc(Cl)ccc3N)cn2)cc1.Cc1ccccc1.
What is the InChIKey of methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene?
The InChIKey is LYRHDEPXGSDCFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19ClN4O3.C7H8/c1-29-21(28)26-16-6-2-13(3-7-16)20(27)25-12-17-8-4-14(11-24-17)18-10-15(22)5-9-19(18)23;1-7-5-3-2-4-6-7/h2-11H,12,23H2,1H3,(H,25,27)(H,26,28);2-6H,1H3.
What are the key properties of methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene?
methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene has a molecular weight of 503.00 g/mol, XLogP of 6.09, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[4-[[5-(2-amino-5-chlorophenyl)-2-pyridinyl]methylcarbamoyl]phenyl]carbamate;toluene is sourced from PubChem (CID 145323256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).