About 5-(4-methylphenyl)-1,3-diphenylpyrazole
5-(4-methylphenyl)-1,3-diphenylpyrazole (PubChem CID 14532338) has the molecular formula C22H18N2
and a molecular weight of 310.40 g/mol. Its IUPAC name is 5-(4-methylphenyl)-1,3-diphenylpyrazole.
Molecular Properties
| Compound Name | 5-(4-methylphenyl)-1,3-diphenylpyrazole |
| PubChem CID | 14532338 |
| Molecular Formula | C22H18N2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 5-(4-methylphenyl)-1,3-diphenylpyrazole |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N2/c1-17-12-14-19(15-13-17)22-16-21(18-8-4-2-5-9-18)23-24(22)20-10-6-3-7-11-20/h2-16H,1H3 |
| InChIKey | HBLZCAKQOWHDPU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-methylphenyl)-1,3-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylphenyl)-1,3-diphenylpyrazole?
The IUPAC name of 5-(4-methylphenyl)-1,3-diphenylpyrazole (CID 14532338) is 5-(4-methylphenyl)-1,3-diphenylpyrazole.
What is the SMILES notation for 5-(4-methylphenyl)-1,3-diphenylpyrazole?
The canonical SMILES for 5-(4-methylphenyl)-1,3-diphenylpyrazole is Cc1ccc(-c2cc(-c3ccccc3)nn2-c2ccccc2)cc1.
What is the InChIKey of 5-(4-methylphenyl)-1,3-diphenylpyrazole?
The InChIKey is HBLZCAKQOWHDPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2/c1-17-12-14-19(15-13-17)22-16-21(18-8-4-2-5-9-18)23-24(22)20-10-6-3-7-11-20/h2-16H,1H3.
What are the key properties of 5-(4-methylphenyl)-1,3-diphenylpyrazole?
5-(4-methylphenyl)-1,3-diphenylpyrazole has a molecular weight of 310.40 g/mol, XLogP of 5.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylphenyl)-1,3-diphenylpyrazole is sourced from PubChem (CID 14532338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).