About ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine
ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine (PubChem CID 145323521) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine.
Molecular Properties
| Compound Name | ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine |
| PubChem CID | 145323521 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine |
| SMILES | CC.Cn1ncc2c1=CCNC=2 |
| InChI | InChI=1S/C7H9N3.C2H6/c1-10-7-2-3-8-4-6(7)5-9-10;1-2/h2,4-5,8H,3H2,1H3;1-2H3 |
| InChIKey | BKUYAWHNWCEAOJ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine?
The IUPAC name of ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine (CID 145323521) is ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine.
What is the SMILES notation for ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine?
The canonical SMILES for ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine is CC.Cn1ncc2c1=CCNC=2.
What is the InChIKey of ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine?
The InChIKey is BKUYAWHNWCEAOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3.C2H6/c1-10-7-2-3-8-4-6(7)5-9-10;1-2/h2,4-5,8H,3H2,1H3;1-2H3.
What are the key properties of ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine?
ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine has a molecular weight of 165.24 g/mol, XLogP of -0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-5,6-dihydropyrazolo[4,3-c]pyridine is sourced from PubChem (CID 145323521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).