C21H35NO3 — CID 145323999
tert-butyl (2R,5R)-2-(cyclohexa-1,5-dien-1-ylmethyl)-5-ethenoxypiperidine-1-carboxylate;ethane (PubChem CID 145323999) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is tert-butyl (2R,5R)-2-(cyclohexa-1,5-dien-1-ylmethyl)-5-ethenoxypiperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl (2R,5R)-2-(cyclohexa-1,5-dien-1-ylmethyl)-5-ethenoxypiperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 145323999 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | tert-butyl (2R,5R)-2-(cyclohexa-1,5-dien-1-ylmethyl)-5-ethenoxypiperidine-1-carboxylate;ethane |
| SMILES | C=CO[C@@H]1CC[C@H](CC2=CCCC=C2)N(C(=O)OC(C)(C)C)C1.CC |
| InChI | InChI=1S/C19H29NO3.C2H6/c1-5-22-17-12-11-16(13-15-9-7-6-8-10-15)20(14-17)18(21)23-19(2,3)4;1-2/h5,7,9-10,16-17H,1,6,8,11-14H2,2-4H3;1-2H3/t16-,17-;/m1./s1 |
| InChIKey | ZFDZVVSENDXZAD-GBNZRNLASA-N |
| XLogP | 5.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|