C19H29NO3 — CID 145324000
tert-butyl (2R,5R)-2-(cyclohexa-1,5-dien-1-ylmethyl)-5-ethenoxypiperidine-1-carboxylate (PubChem CID 145324000) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is tert-butyl (2R,5R)-2-(cyclohexa-1,5-dien-1-ylmethyl)-5-ethenoxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,5R)-2-(cyclohexa-1,5-dien-1-ylmethyl)-5-ethenoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 145324000 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | tert-butyl (2R,5R)-2-(cyclohexa-1,5-dien-1-ylmethyl)-5-ethenoxypiperidine-1-carboxylate |
| SMILES | C=CO[C@@H]1CC[C@H](CC2=CCCC=C2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H29NO3/c1-5-22-17-12-11-16(13-15-9-7-6-8-10-15)20(14-17)18(21)23-19(2,3)4/h5,7,9-10,16-17H,1,6,8,11-14H2,2-4H3/t16-,17-/m1/s1 |
| InChIKey | IHCRXGDCLDOANF-IAGOWNOFSA-N |
| XLogP | 4.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|