About (3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine
(3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine (PubChem CID 145324654) has the molecular formula C10H12FN
and a molecular weight of 165.21 g/mol. Its IUPAC name is (3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine.
Molecular Properties
| Compound Name | (3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine |
| PubChem CID | 145324654 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine |
| SMILES | [H]/N=C/C(=C)/C(C=C)=C/C(F)=C\C |
| InChI | InChI=1S/C10H12FN/c1-4-9(8(3)7-12)6-10(11)5-2/h4-7,12H,1,3H2,2H3/b9-6+,10-5+,12-7+ |
| InChIKey | QRPKRNBZHOXKDX-JNZZVHFRSA-N |
| XLogP | 3.18 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine?
The IUPAC name of (3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine (CID 145324654) is (3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine.
What is the SMILES notation for (3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine?
The canonical SMILES for (3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine is [H]/N=C/C(=C)/C(C=C)=C/C(F)=C\C.
What is the InChIKey of (3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine?
The InChIKey is QRPKRNBZHOXKDX-JNZZVHFRSA-N. The full InChI is InChI=1S/C10H12FN/c1-4-9(8(3)7-12)6-10(11)5-2/h4-7,12H,1,3H2,2H3/b9-6+,10-5+,12-7+.
What are the key properties of (3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine?
(3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine has a molecular weight of 165.21 g/mol, XLogP of 3.18, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-3-ethenyl-5-fluoro-2-methylidenehepta-3,5-dien-1-imine is sourced from PubChem (CID 145324654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).