C15H19NO — CID 145324733
(2E,4E,6E)-2-methanimidoyl-4-methyl-6-(2-methylprop-1-enyl)nona-2,4,6,8-tetraenal (PubChem CID 145324733) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (2E,4E,6E)-2-methanimidoyl-4-methyl-6-(2-methylprop-1-enyl)nona-2,4,6,8-tetraenal.
| Compound Name | (2E,4E,6E)-2-methanimidoyl-4-methyl-6-(2-methylprop-1-enyl)nona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 145324733 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (2E,4E,6E)-2-methanimidoyl-4-methyl-6-(2-methylprop-1-enyl)nona-2,4,6,8-tetraenal |
| SMILES | [H]/N=C/C(C=O)=C\C(C)=C\C(C=C(C)C)=C\C=C |
| InChI | InChI=1S/C15H19NO/c1-5-6-14(7-12(2)3)8-13(4)9-15(10-16)11-17/h5-11,16H,1H2,2-4H3/b13-8+,14-6+,15-9+,16-10+ |
| InChIKey | FCGJDIWCXOMBKW-XCJGOQQPSA-N |
| XLogP | 3.79 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|