C18H20N6S — CID 145324828
2-[1-propan-2-ylsulfanyl-3-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 145324828) has the molecular formula C18H20N6S and a molecular weight of 352.47 g/mol. Its IUPAC name is 2-[1-propan-2-ylsulfanyl-3-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-propan-2-ylsulfanyl-3-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 145324828 |
| Molecular Formula | C18H20N6S |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[1-propan-2-ylsulfanyl-3-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | CC(C)SN1CC(CC#N)(n2cc(-c3ccnc4[nH]ccc34)cn2)C1 |
| InChI | InChI=1S/C18H20N6S/c1-13(2)25-23-11-18(12-23,5-6-19)24-10-14(9-22-24)15-3-7-20-17-16(15)4-8-21-17/h3-4,7-10,13H,5,11-12H2,1-2H3,(H,20,21) |
| InChIKey | HMGASDAESPHLQW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 73.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|