About 7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine
7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine (PubChem CID 145325433) has the molecular formula C15H19F3N2
and a molecular weight of 284.32 g/mol. Its IUPAC name is 7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine.
Molecular Properties
| Compound Name | 7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine |
| PubChem CID | 145325433 |
| Molecular Formula | C15H19F3N2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine |
| SMILES | CC(C)N1CC=C(C2=CC(C(F)(F)F)=CCC=N2)CC1 |
| InChI | InChI=1S/C15H19F3N2/c1-11(2)20-8-5-12(6-9-20)14-10-13(15(16,17)18)4-3-7-19-14/h4-5,7,10-11H,3,6,8-9H2,1-2H3 |
| InChIKey | NTMRKAJGTMNJBU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine?
The IUPAC name of 7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine (CID 145325433) is 7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine.
What is the SMILES notation for 7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine?
The canonical SMILES for 7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine is CC(C)N1CC=C(C2=CC(C(F)(F)F)=CCC=N2)CC1.
What is the InChIKey of 7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine?
The InChIKey is NTMRKAJGTMNJBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F3N2/c1-11(2)20-8-5-12(6-9-20)14-10-13(15(16,17)18)4-3-7-19-14/h4-5,7,10-11H,3,6,8-9H2,1-2H3.
What are the key properties of 7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine?
7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine has a molecular weight of 284.32 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)-5-(trifluoromethyl)-3H-azepine is sourced from PubChem (CID 145325433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).