C16H25NO2 — CID 145325804
1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbaldehyde;(3E)-3-(methoxymethyl)hexa-1,3,5-triene (PubChem CID 145325804) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbaldehyde;(3E)-3-(methoxymethyl)hexa-1,3,5-triene.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbaldehyde;(3E)-3-(methoxymethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 145325804 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbaldehyde;(3E)-3-(methoxymethyl)hexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C)COC.O=CC1CC2CCCC2N1 |
| InChI | InChI=1S/C8H13NO.C8H12O/c10-5-7-4-6-2-1-3-8(6)9-7;1-4-6-8(5-2)7-9-3/h5-9H,1-4H2;4-6H,1-2,7H2,3H3/b;8-6+ |
| InChIKey | CEXYNTYUKDJGSG-ZQGZPJDTSA-N |
| XLogP | 2.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|