C17H32N6O7S — CID 145325949
1-methylpiperazine;[(2S)-7-oxo-2-[[(2R)-pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 145325949) has the molecular formula C17H32N6O7S and a molecular weight of 464.55 g/mol. Its IUPAC name is 1-methylpiperazine;[(2S)-7-oxo-2-[[(2R)-pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | 1-methylpiperazine;[(2S)-7-oxo-2-[[(2R)-pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 145325949 |
| Molecular Formula | C17H32N6O7S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-methylpiperazine;[(2S)-7-oxo-2-[[(2R)-pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CN1CCNCC1.O=C(NOC[C@H]1CCCN1)[C@@H]1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H20N4O7S.C5H12N2/c17-11(14-22-7-8-2-1-5-13-8)10-4-3-9-6-15(10)12(18)16(9)23-24(19,20)21;1-7-4-2-6-3-5-7/h8-10,13H,1-7H2,(H,14,17)(H,19,20,21);6H,2-5H2,1H3/t8-,9?,10+;/m1./s1 |
| InChIKey | DOMICCIOVWHAIS-NKUWADJFSA-N |
| XLogP | -1.69 |
| TPSA | 152.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|