C14H19N — CID 145326202
ethane;1-methyl-3,6,7,8-tetrahydrocyclopenta[e]indole (PubChem CID 145326202) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is ethane;1-methyl-3,6,7,8-tetrahydrocyclopenta[e]indole.
| Compound Name | ethane;1-methyl-3,6,7,8-tetrahydrocyclopenta[e]indole |
|---|---|
| PubChem CID | 145326202 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | ethane;1-methyl-3,6,7,8-tetrahydrocyclopenta[e]indole |
| SMILES | CC.Cc1c[nH]c2ccc3c(c12)CCC3 |
| InChI | InChI=1S/C12H13N.C2H6/c1-8-7-13-11-6-5-9-3-2-4-10(9)12(8)11;1-2/h5-7,13H,2-4H2,1H3;1-2H3 |
| InChIKey | COGPGTPNVPZZOU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |