C13H23NO — CID 145326246
5,6-bis[(Z)-prop-1-enyl]-3,4-dihydro-2H-1,3-oxazine;propane (PubChem CID 145326246) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 5,6-bis[(Z)-prop-1-enyl]-3,4-dihydro-2H-1,3-oxazine;propane.
| Compound Name | 5,6-bis[(Z)-prop-1-enyl]-3,4-dihydro-2H-1,3-oxazine;propane |
|---|---|
| PubChem CID | 145326246 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 5,6-bis[(Z)-prop-1-enyl]-3,4-dihydro-2H-1,3-oxazine;propane |
| SMILES | C/C=C\C1=C(/C=C\C)OCNC1.CCC |
| InChI | InChI=1S/C10H15NO.C3H8/c1-3-5-9-7-11-8-12-10(9)6-4-2;1-3-2/h3-6,11H,7-8H2,1-2H3;3H2,1-2H3/b5-3-,6-4-; |
| InChIKey | GHCRSKIJABDVLX-VIOUERSGSA-N |
| XLogP | 3.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |