About 2,7,7-trimethylcyclohepta[b]pyridine;yttrium
2,7,7-trimethylcyclohepta[b]pyridine;yttrium (PubChem CID 145326449) has the molecular formula C13H15NY
and a molecular weight of 274.18 g/mol. Its IUPAC name is 2,7,7-trimethylcyclohepta[b]pyridine;yttrium.
Molecular Properties
| Compound Name | 2,7,7-trimethylcyclohepta[b]pyridine;yttrium |
| PubChem CID | 145326449 |
| Molecular Formula | C13H15NY |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 2,7,7-trimethylcyclohepta[b]pyridine;yttrium |
| SMILES | Cc1ccc2c(n1)C=CC(C)(C)C=C2.[Y] |
| InChI | InChI=1S/C13H15N.Y/c1-10-4-5-11-6-8-13(2,3)9-7-12(11)14-10;/h4-9H,1-3H3; |
| InChIKey | AUVWRPYHLDXORY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,7,7-trimethylcyclohepta[b]pyridine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7,7-trimethylcyclohepta[b]pyridine;yttrium?
The IUPAC name of 2,7,7-trimethylcyclohepta[b]pyridine;yttrium (CID 145326449) is 2,7,7-trimethylcyclohepta[b]pyridine;yttrium.
What is the SMILES notation for 2,7,7-trimethylcyclohepta[b]pyridine;yttrium?
The canonical SMILES for 2,7,7-trimethylcyclohepta[b]pyridine;yttrium is Cc1ccc2c(n1)C=CC(C)(C)C=C2.[Y].
What is the InChIKey of 2,7,7-trimethylcyclohepta[b]pyridine;yttrium?
The InChIKey is AUVWRPYHLDXORY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N.Y/c1-10-4-5-11-6-8-13(2,3)9-7-12(11)14-10;/h4-9H,1-3H3;.
What are the key properties of 2,7,7-trimethylcyclohepta[b]pyridine;yttrium?
2,7,7-trimethylcyclohepta[b]pyridine;yttrium has a molecular weight of 274.18 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7,7-trimethylcyclohepta[b]pyridine;yttrium is sourced from PubChem (CID 145326449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).