C18H21Cl2NO5 — CID 14532673
dimethyl 3,5-dichloro-2-methoxy-2,6-dimethyl-4-phenyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 14532673) has the molecular formula C18H21Cl2NO5 and a molecular weight of 402.27 g/mol. Its IUPAC name is dimethyl 3,5-dichloro-2-methoxy-2,6-dimethyl-4-phenyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 3,5-dichloro-2-methoxy-2,6-dimethyl-4-phenyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14532673 |
| Molecular Formula | C18H21Cl2NO5 |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | dimethyl 3,5-dichloro-2-methoxy-2,6-dimethyl-4-phenyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1(Cl)C(C)=NC(C)(OC)C(Cl)(C(=O)OC)C1c1ccccc1 |
| InChI | InChI=1S/C18H21Cl2NO5/c1-11-17(19,14(22)24-3)13(12-9-7-6-8-10-12)18(20,15(23)25-4)16(2,21-11)26-5/h6-10,13H,1-5H3 |
| InChIKey | VUPNLCAQXLMUFP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|