C60H42N4 — CID 145327538
5-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-(9,9-dimethylfluoren-2-yl)-9-phenylcarbazole (PubChem CID 145327538) has the molecular formula C60H42N4 and a molecular weight of 819.02 g/mol. Its IUPAC name is 5-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-(9,9-dimethylfluoren-2-yl)-9-phenylcarbazole.
| Compound Name | 5-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-(9,9-dimethylfluoren-2-yl)-9-phenylcarbazole |
|---|---|
| PubChem CID | 145327538 |
| Molecular Formula | C60H42N4 |
| Molecular Weight | 819.02 g/mol |
| Exact Mass | 818.34 |
| IUPAC Name | 5-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-(9,9-dimethylfluoren-2-yl)-9-phenylcarbazole |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc4c(c3)c3c(-c5nc(-c6ccc(-c7ccccc7)cc6)nc(-c6ccc(-c7ccccc7)cc6)n5)cccc3n4-c3ccccc3)cc21 |
| InChI | InChI=1S/C60H42N4/c1-60(2)52-23-13-12-21-48(52)49-35-33-46(38-53(49)60)45-34-36-54-51(37-45)56-50(22-14-24-55(56)64(54)47-19-10-5-11-20-47)59-62-57(43-29-25-41(26-30-43)39-15-6-3-7-16-39)61-58(63-59)44-31-27-42(28-32-44)40-17-8-4-9-18-40/h3-38H,1-2H3 |
| InChIKey | IGLDUADPRIOKJZ-UHFFFAOYSA-N |
| XLogP | 15.28 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.02 |
| LogP ≤ 5 | 15.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |