About ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane
ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane (PubChem CID 145327739) has the molecular formula C25H41N
and a molecular weight of 355.61 g/mol. Its IUPAC name is ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane.
Molecular Properties
| Compound Name | ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane |
| PubChem CID | 145327739 |
| Molecular Formula | C25H41N |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.32 |
| IUPAC Name | ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane |
| SMILES | C=Cc1c(C)c2c(c3cccnc13)C=CCC2.CC.CC.CC.CCC |
| InChI | InChI=1S/C16H15N.C3H8.3C2H6/c1-3-12-11(2)13-7-4-5-8-14(13)15-9-6-10-17-16(12)15;1-3-2;3*1-2/h3,5-6,8-10H,1,4,7H2,2H3;3H2,1-2H3;3*1-2H3 |
| InChIKey | LNFDOBXSTDWUSP-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane?
The IUPAC name of ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane (CID 145327739) is ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane.
What is the SMILES notation for ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane?
The canonical SMILES for ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane is C=Cc1c(C)c2c(c3cccnc13)C=CCC2.CC.CC.CC.CCC.
What is the InChIKey of ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane?
The InChIKey is LNFDOBXSTDWUSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N.C3H8.3C2H6/c1-3-12-11(2)13-7-4-5-8-14(13)15-9-6-10-17-16(12)15;1-3-2;3*1-2/h3,5-6,8-10H,1,4,7H2,2H3;3H2,1-2H3;3*1-2H3.
What are the key properties of ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane?
ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane has a molecular weight of 355.61 g/mol, XLogP of 8.64, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethenyl-6-methyl-7,8-dihydrobenzo[f]quinoline;propane is sourced from PubChem (CID 145327739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).