C66H46N4 — CID 145327834
6-(9,9-dimethylfluoren-1-yl)-9-(3,5-diphenylphenyl)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]carbazole (PubChem CID 145327834) has the molecular formula C66H46N4 and a molecular weight of 895.12 g/mol. Its IUPAC name is 6-(9,9-dimethylfluoren-1-yl)-9-(3,5-diphenylphenyl)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]carbazole.
| Compound Name | 6-(9,9-dimethylfluoren-1-yl)-9-(3,5-diphenylphenyl)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]carbazole |
|---|---|
| PubChem CID | 145327834 |
| Molecular Formula | C66H46N4 |
| Molecular Weight | 895.12 g/mol |
| Exact Mass | 894.37 |
| IUPAC Name | 6-(9,9-dimethylfluoren-1-yl)-9-(3,5-diphenylphenyl)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cccc(-c3ccc4c(c3)c3ccc(-c5ccc(-c6cc(-c7ccccn7)nc(-c7ccccn7)c6)cc5)cc3n4-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c21 |
| InChI | InChI=1S/C66H46N4/c1-66(2)58-23-10-9-20-54(58)56-22-15-21-53(65(56)66)48-31-33-63-57(39-48)55-32-30-47(42-64(55)70(63)52-37-49(43-16-5-3-6-17-43)36-50(38-52)44-18-7-4-8-19-44)45-26-28-46(29-27-45)51-40-61(59-24-11-13-34-67-59)69-62(41-51)60-25-12-14-35-68-60/h3-42H,1-2H3 |
| InChIKey | SCIZBWBKWLXXBO-UHFFFAOYSA-N |
| XLogP | 16.94 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.12 |
| LogP ≤ 5 | 16.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |