About N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide
N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide (PubChem CID 145328883) has the molecular formula C17H32N2O3
and a molecular weight of 312.45 g/mol. Its IUPAC name is N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide.
Molecular Properties
| Compound Name | N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide |
| PubChem CID | 145328883 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide |
| SMILES | CCCCCC(=O)N[C@@H]1COC[C@H](NC(=O)CCCCC)C1 |
| InChI | InChI=1S/C17H32N2O3/c1-3-5-7-9-16(20)18-14-11-15(13-22-12-14)19-17(21)10-8-6-4-2/h14-15H,3-13H2,1-2H3,(H,18,20)(H,19,21)/t14-,15+ |
| InChIKey | XZGGRWNLRBDNDS-GASCZTMLSA-N |
| XLogP | 2.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide?
The IUPAC name of N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide (CID 145328883) is N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide.
What is the SMILES notation for N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide?
The canonical SMILES for N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide is CCCCCC(=O)N[C@@H]1COC[C@H](NC(=O)CCCCC)C1.
What is the InChIKey of N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide?
The InChIKey is XZGGRWNLRBDNDS-GASCZTMLSA-N. The full InChI is InChI=1S/C17H32N2O3/c1-3-5-7-9-16(20)18-14-11-15(13-22-12-14)19-17(21)10-8-6-4-2/h14-15H,3-13H2,1-2H3,(H,18,20)(H,19,21)/t14-,15+.
What are the key properties of N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide?
N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide has a molecular weight of 312.45 g/mol, XLogP of 2.54, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,5R)-5-(hexanoylamino)oxan-3-yl]hexanamide is sourced from PubChem (CID 145328883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).