About [(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane
[(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane (PubChem CID 145328961) has the molecular formula C25H31ClN2O2
and a molecular weight of 426.99 g/mol. Its IUPAC name is [(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane.
Molecular Properties
| Compound Name | [(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane |
| PubChem CID | 145328961 |
| Molecular Formula | C25H31ClN2O2 |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | [(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane |
| SMILES | CC1CCC[C@H](OC(=O)Cn2c(-c3cccc(Cl)c3)nc3ccccc32)C1.CCC |
| InChI | InChI=1S/C22H23ClN2O2.C3H8/c1-15-6-4-9-18(12-15)27-21(26)14-25-20-11-3-2-10-19(20)24-22(25)16-7-5-8-17(23)13-16;1-3-2/h2-3,5,7-8,10-11,13,15,18H,4,6,9,12,14H2,1H3;3H2,1-2H3/t15?,18-;/m0./s1 |
| InChIKey | QPMNJCKBQVIOAP-PBCDJRLTSA-N |
| XLogP | 6.89 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane?
The IUPAC name of [(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane (CID 145328961) is [(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane.
What is the SMILES notation for [(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane?
The canonical SMILES for [(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane is CC1CCC[C@H](OC(=O)Cn2c(-c3cccc(Cl)c3)nc3ccccc32)C1.CCC.
What is the InChIKey of [(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane?
The InChIKey is QPMNJCKBQVIOAP-PBCDJRLTSA-N. The full InChI is InChI=1S/C22H23ClN2O2.C3H8/c1-15-6-4-9-18(12-15)27-21(26)14-25-20-11-3-2-10-19(20)24-22(25)16-7-5-8-17(23)13-16;1-3-2/h2-3,5,7-8,10-11,13,15,18H,4,6,9,12,14H2,1H3;3H2,1-2H3/t15?,18-;/m0./s1.
What are the key properties of [(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane?
[(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane has a molecular weight of 426.99 g/mol, XLogP of 6.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-3-methylcyclohexyl] 2-[2-(3-chlorophenyl)benzimidazol-1-yl]acetate;propane is sourced from PubChem (CID 145328961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).