C27H35N3O2 — CID 145328972
[(3R)-3-methylcyclohexyl] (2R)-2-[2-[4-(diethylamino)phenyl]benzimidazol-1-yl]propanoate (PubChem CID 145328972) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is [(3R)-3-methylcyclohexyl] (2R)-2-[2-[4-(diethylamino)phenyl]benzimidazol-1-yl]propanoate.
| Compound Name | [(3R)-3-methylcyclohexyl] (2R)-2-[2-[4-(diethylamino)phenyl]benzimidazol-1-yl]propanoate |
|---|---|
| PubChem CID | 145328972 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | [(3R)-3-methylcyclohexyl] (2R)-2-[2-[4-(diethylamino)phenyl]benzimidazol-1-yl]propanoate |
| SMILES | CCN(CC)c1ccc(-c2nc3ccccc3n2[C@H](C)C(=O)OC2CCC[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C27H35N3O2/c1-5-29(6-2)22-16-14-21(15-17-22)26-28-24-12-7-8-13-25(24)30(26)20(4)27(31)32-23-11-9-10-19(3)18-23/h7-8,12-17,19-20,23H,5-6,9-11,18H2,1-4H3/t19-,20-,23?/m1/s1 |
| InChIKey | ZGDBDJVXGOPJDE-VJOPYQGCSA-N |
| XLogP | 6.23 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|