C16H20BF2NO3 — CID 145329065
4,4-difluoro-N-[(3R)-2-hydroxy-8-prop-1-en-2-yl-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanamide (PubChem CID 145329065) has the molecular formula C16H20BF2NO3 and a molecular weight of 323.15 g/mol. Its IUPAC name is 4,4-difluoro-N-[(3R)-2-hydroxy-8-prop-1-en-2-yl-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanamide.
| Compound Name | 4,4-difluoro-N-[(3R)-2-hydroxy-8-prop-1-en-2-yl-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanamide |
|---|---|
| PubChem CID | 145329065 |
| Molecular Formula | C16H20BF2NO3 |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 4,4-difluoro-N-[(3R)-2-hydroxy-8-prop-1-en-2-yl-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanamide |
| SMILES | C=C(C)c1cccc2c1OB(O)[C@@H](NC(=O)CCC(C)(F)F)C2 |
| InChI | InChI=1S/C16H20BF2NO3/c1-10(2)12-6-4-5-11-9-13(17(22)23-15(11)12)20-14(21)7-8-16(3,18)19/h4-6,13,22H,1,7-9H2,2-3H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | PGEAYLWQRUJOST-ZDUSSCGKSA-N |
| XLogP | 2.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|