C29H39FN4O2 — CID 145329387
ethane;1-[4-[7-(2-fluoro-6-hydroxyphenyl)-8-methyl-6-propylquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 145329387) has the molecular formula C29H39FN4O2 and a molecular weight of 494.66 g/mol. Its IUPAC name is ethane;1-[4-[7-(2-fluoro-6-hydroxyphenyl)-8-methyl-6-propylquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | ethane;1-[4-[7-(2-fluoro-6-hydroxyphenyl)-8-methyl-6-propylquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 145329387 |
| Molecular Formula | C29H39FN4O2 |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | ethane;1-[4-[7-(2-fluoro-6-hydroxyphenyl)-8-methyl-6-propylquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c(C)c(-c4c(O)cccc4F)c(CCC)cc23)CC1.CC.CC |
| InChI | InChI=1S/C25H27FN4O2.2C2H6/c1-4-7-17-14-18-24(16(3)22(17)23-19(26)8-6-9-20(23)31)27-15-28-25(18)30-12-10-29(11-13-30)21(32)5-2;2*1-2/h5-6,8-9,14-15,31H,2,4,7,10-13H2,1,3H3;2*1-2H3 |
| InChIKey | APGVYCSMZMAQOY-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|