About 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine
2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine (PubChem CID 145329667) has the molecular formula C16H22BrFN2O2S
and a molecular weight of 405.33 g/mol. Its IUPAC name is 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine.
Molecular Properties
| Compound Name | 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine |
| PubChem CID | 145329667 |
| Molecular Formula | C16H22BrFN2O2S |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine |
| SMILES | CC.CN1CCC(F)C1.O=CCn1ccc2scc(Br)c2c1=O |
| InChI | InChI=1S/C9H6BrNO2S.C5H10FN.C2H6/c10-6-5-14-7-1-2-11(3-4-12)9(13)8(6)7;1-7-3-2-5(6)4-7;1-2/h1-2,4-5H,3H2;5H,2-4H2,1H3;1-2H3 |
| InChIKey | MALLMOLARIYZCD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine?
The IUPAC name of 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine (CID 145329667) is 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine.
What is the SMILES notation for 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine?
The canonical SMILES for 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine is CC.CN1CCC(F)C1.O=CCn1ccc2scc(Br)c2c1=O.
What is the InChIKey of 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine?
The InChIKey is MALLMOLARIYZCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrNO2S.C5H10FN.C2H6/c10-6-5-14-7-1-2-11(3-4-12)9(13)8(6)7;1-7-3-2-5(6)4-7;1-2/h1-2,4-5H,3H2;5H,2-4H2,1H3;1-2H3.
What are the key properties of 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine?
2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine has a molecular weight of 405.33 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde;ethane;3-fluoro-1-methylpyrrolidine is sourced from PubChem (CID 145329667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).